C11H16N4O3 — CID 144971063
methyl N-[2-[(2R)-2-(1H-imidazol-2-yl)pyrrolidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 144971063) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl N-[2-[(2R)-2-(1H-imidazol-2-yl)pyrrolidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | methyl N-[2-[(2R)-2-(1H-imidazol-2-yl)pyrrolidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 144971063 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | methyl N-[2-[(2R)-2-(1H-imidazol-2-yl)pyrrolidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | COC(=O)NCC(=O)N1CCC[C@@H]1c1ncc[nH]1 |
| InChI | InChI=1S/C11H16N4O3/c1-18-11(17)14-7-9(16)15-6-2-3-8(15)10-12-4-5-13-10/h4-5,8H,2-3,6-7H2,1H3,(H,12,13)(H,14,17)/t8-/m1/s1 |
| InChIKey | UNBVFJWQBZWWSW-MRVPVSSYSA-N |
| XLogP | 0.43 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |