About [(2S,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl butanoate
[(2S,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl butanoate (PubChem CID 144971544) has the molecular formula C15H22N2O4
and a molecular weight of 294.35 g/mol. Its IUPAC name is [(2S,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl butanoate.
Molecular Properties
| Compound Name | [(2S,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl butanoate |
| PubChem CID | 144971544 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | [(2S,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@@H]1CC[C@H](N2C=CCC(C(N)=O)=C2)O1 |
| InChI | InChI=1S/C15H22N2O4/c1-2-4-14(18)20-10-12-6-7-13(21-12)17-8-3-5-11(9-17)15(16)19/h3,8-9,12-13H,2,4-7,10H2,1H3,(H2,16,19)/t12-,13+/m0/s1 |
| InChIKey | GDJJQOONIAKKLW-QWHCGFSZSA-N |
| XLogP | 1.42 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2S,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl butanoate?
The IUPAC name of [(2S,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl butanoate (CID 144971544) is [(2S,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl butanoate.
What is the SMILES notation for [(2S,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl butanoate?
The canonical SMILES for [(2S,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl butanoate is CCCC(=O)OC[C@@H]1CC[C@H](N2C=CCC(C(N)=O)=C2)O1.
What is the InChIKey of [(2S,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl butanoate?
The InChIKey is GDJJQOONIAKKLW-QWHCGFSZSA-N. The full InChI is InChI=1S/C15H22N2O4/c1-2-4-14(18)20-10-12-6-7-13(21-12)17-8-3-5-11(9-17)15(16)19/h3,8-9,12-13H,2,4-7,10H2,1H3,(H2,16,19)/t12-,13+/m0/s1.
What are the key properties of [(2S,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl butanoate?
[(2S,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl butanoate has a molecular weight of 294.35 g/mol, XLogP of 1.42, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl butanoate is sourced from PubChem (CID 144971544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).