C21H20FN5O3 — CID 144972371
N-[(1E,3Z)-1,4-diamino-4-(5-fluoro-3-pyridinyl)buta-1,3-dienyl]-2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)acetamide (PubChem CID 144972371) has the molecular formula C21H20FN5O3 and a molecular weight of 409.42 g/mol. Its IUPAC name is N-[(1E,3Z)-1,4-diamino-4-(5-fluoro-3-pyridinyl)buta-1,3-dienyl]-2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)acetamide.
| Compound Name | N-[(1E,3Z)-1,4-diamino-4-(5-fluoro-3-pyridinyl)buta-1,3-dienyl]-2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)acetamide |
|---|---|
| PubChem CID | 144972371 |
| Molecular Formula | C21H20FN5O3 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[(1E,3Z)-1,4-diamino-4-(5-fluoro-3-pyridinyl)buta-1,3-dienyl]-2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)acetamide |
| SMILES | Cc1cc(CC(=O)N/C(N)=C/C=C(\N)c2cncc(F)c2)c2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C21H20FN5O3/c1-11-5-12(19-15(6-11)20(29)27(2)21(19)30)8-18(28)26-17(24)4-3-16(23)13-7-14(22)10-25-9-13/h3-7,9-10H,8,23-24H2,1-2H3,(H,26,28)/b16-3-,17-4+ |
| InChIKey | CVGHYJJBRMNEOP-BTDHQHPHSA-N |
| XLogP | 1.21 |
| TPSA | 131.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|