C25H30N4O3 — CID 144972452
2-(2-cyclopropyl-6-methyl-1,3-dioxoisoindol-4-yl)-N-[(1E,3Z,5E)-1,4-diamino-5-[(Z)-prop-1-enyl]octa-1,3,5-trienyl]acetamide (PubChem CID 144972452) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-(2-cyclopropyl-6-methyl-1,3-dioxoisoindol-4-yl)-N-[(1E,3Z,5E)-1,4-diamino-5-[(Z)-prop-1-enyl]octa-1,3,5-trienyl]acetamide.
| Compound Name | 2-(2-cyclopropyl-6-methyl-1,3-dioxoisoindol-4-yl)-N-[(1E,3Z,5E)-1,4-diamino-5-[(Z)-prop-1-enyl]octa-1,3,5-trienyl]acetamide |
|---|---|
| PubChem CID | 144972452 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 2-(2-cyclopropyl-6-methyl-1,3-dioxoisoindol-4-yl)-N-[(1E,3Z,5E)-1,4-diamino-5-[(Z)-prop-1-enyl]octa-1,3,5-trienyl]acetamide |
| SMILES | C/C=C\C(=C/CC)\C(N)=C\C=C(/N)NC(=O)Cc1cc(C)cc2c1C(=O)N(C1CC1)C2=O |
| InChI | InChI=1S/C25H30N4O3/c1-4-6-16(7-5-2)20(26)10-11-21(27)28-22(30)14-17-12-15(3)13-19-23(17)25(32)29(24(19)31)18-8-9-18/h4,6-7,10-13,18H,5,8-9,14,26-27H2,1-3H3,(H,28,30)/b6-4-,16-7+,20-10-,21-11+ |
| InChIKey | RLUYMIIFZGOFHO-NHFMFHDMSA-N |
| XLogP | 2.97 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|