C24H21F5N8O — CID 144972715
4-amino-2-[3-amino-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-5-methyl-5-(4-methylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 144972715) has the molecular formula C24H21F5N8O and a molecular weight of 532.48 g/mol. Its IUPAC name is 4-amino-2-[3-amino-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-5-methyl-5-(4-methylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-2-[3-amino-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-5-methyl-5-(4-methylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 144972715 |
| Molecular Formula | C24H21F5N8O |
| Molecular Weight | 532.48 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | 4-amino-2-[3-amino-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-5-methyl-5-(4-methylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | Cc1ccc(C2(C)C(=O)Nc3nc(-c4cn5c(N)cnc5c(CCC(F)(F)C(F)(F)F)n4)nc(N)c32)cc1 |
| InChI | InChI=1S/C24H21F5N8O/c1-11-3-5-12(6-4-11)22(2)16-17(31)34-18(35-19(16)36-21(22)38)14-10-37-15(30)9-32-20(37)13(33-14)7-8-23(25,26)24(27,28)29/h3-6,9-10H,7-8,30H2,1-2H3,(H3,31,34,35,36,38) |
| InChIKey | IULOFEABNPPRDZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|