C37H44N4O3 — CID 144973059
ethane;4-methylpenta-1,3-diene;5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile (PubChem CID 144973059) has the molecular formula C37H44N4O3 and a molecular weight of 592.78 g/mol. Its IUPAC name is ethane;4-methylpenta-1,3-diene;5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile.
| Compound Name | ethane;4-methylpenta-1,3-diene;5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
|---|---|
| PubChem CID | 144973059 |
| Molecular Formula | C37H44N4O3 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.34 |
| IUPAC Name | ethane;4-methylpenta-1,3-diene;5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
| SMILES | C=CC=C(C)C.CC.N#Cc1cc(-c2ccnc3[nH]c(-c4ccc(N5CCOCC5)cc4)cc23)ccc1OC1CCOCC1 |
| InChI | InChI=1S/C29H28N4O3.C6H10.C2H6/c30-19-22-17-21(3-6-28(22)36-24-8-13-34-14-9-24)25-7-10-31-29-26(25)18-27(32-29)20-1-4-23(5-2-20)33-11-15-35-16-12-33;1-4-5-6(2)3;1-2/h1-7,10,17-18,24H,8-9,11-16H2,(H,31,32);4-5H,1H2,2-3H3;1-2H3 |
| InChIKey | KAFQKHHHCVUZSP-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|