C34H39N5O3 — CID 144973140
ethane;2-(oxan-4-yloxy)-5-[2-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]benzonitrile (PubChem CID 144973140) has the molecular formula C34H39N5O3 and a molecular weight of 565.72 g/mol. Its IUPAC name is ethane;2-(oxan-4-yloxy)-5-[2-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]benzonitrile.
| Compound Name | ethane;2-(oxan-4-yloxy)-5-[2-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 144973140 |
| Molecular Formula | C34H39N5O3 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.31 |
| IUPAC Name | ethane;2-(oxan-4-yloxy)-5-[2-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]benzonitrile |
| SMILES | CC.N#Cc1cc(-c2ccnc3[nH]c(-c4ccc(N5CCN(C6COC6)CC5)cc4)cc23)ccc1OC1CCOCC1 |
| InChI | InChI=1S/C32H33N5O3.C2H6/c33-19-24-17-23(3-6-31(24)40-27-8-15-38-16-9-27)28-7-10-34-32-29(28)18-30(35-32)22-1-4-25(5-2-22)36-11-13-37(14-12-36)26-20-39-21-26;1-2/h1-7,10,17-18,26-27H,8-9,11-16,20-21H2,(H,34,35);1-2H3 |
| InChIKey | KZCKIJYDNUMXOA-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|