About ethane;4-methyl-1-(oxan-4-yl)pyrazole;2-(3-propan-2-ylphenyl)propan-2-ol
ethane;4-methyl-1-(oxan-4-yl)pyrazole;2-(3-propan-2-ylphenyl)propan-2-ol (PubChem CID 144973147) has the molecular formula C23H38N2O2
and a molecular weight of 374.57 g/mol. Its IUPAC name is ethane;4-methyl-1-(oxan-4-yl)pyrazole;2-(3-propan-2-ylphenyl)propan-2-ol.
Molecular Properties
| Compound Name | ethane;4-methyl-1-(oxan-4-yl)pyrazole;2-(3-propan-2-ylphenyl)propan-2-ol |
| PubChem CID | 144973147 |
| Molecular Formula | C23H38N2O2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | ethane;4-methyl-1-(oxan-4-yl)pyrazole;2-(3-propan-2-ylphenyl)propan-2-ol |
| SMILES | CC.CC(C)c1cccc(C(C)(C)O)c1.Cc1cnn(C2CCOCC2)c1 |
| InChI | InChI=1S/C12H18O.C9H14N2O.C2H6/c1-9(2)10-6-5-7-11(8-10)12(3,4)13;1-8-6-10-11(7-8)9-2-4-12-5-3-9;1-2/h5-9,13H,1-4H3;6-7,9H,2-5H2,1H3;1-2H3 |
| InChIKey | WGOSPAMKPCAVAB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;4-methyl-1-(oxan-4-yl)pyrazole;2-(3-propan-2-ylphenyl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-1-(oxan-4-yl)pyrazole;2-(3-propan-2-ylphenyl)propan-2-ol?
The IUPAC name of ethane;4-methyl-1-(oxan-4-yl)pyrazole;2-(3-propan-2-ylphenyl)propan-2-ol (CID 144973147) is ethane;4-methyl-1-(oxan-4-yl)pyrazole;2-(3-propan-2-ylphenyl)propan-2-ol.
What is the SMILES notation for ethane;4-methyl-1-(oxan-4-yl)pyrazole;2-(3-propan-2-ylphenyl)propan-2-ol?
The canonical SMILES for ethane;4-methyl-1-(oxan-4-yl)pyrazole;2-(3-propan-2-ylphenyl)propan-2-ol is CC.CC(C)c1cccc(C(C)(C)O)c1.Cc1cnn(C2CCOCC2)c1.
What is the InChIKey of ethane;4-methyl-1-(oxan-4-yl)pyrazole;2-(3-propan-2-ylphenyl)propan-2-ol?
The InChIKey is WGOSPAMKPCAVAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O.C9H14N2O.C2H6/c1-9(2)10-6-5-7-11(8-10)12(3,4)13;1-8-6-10-11(7-8)9-2-4-12-5-3-9;1-2/h5-9,13H,1-4H3;6-7,9H,2-5H2,1H3;1-2H3.
What are the key properties of ethane;4-methyl-1-(oxan-4-yl)pyrazole;2-(3-propan-2-ylphenyl)propan-2-ol?
ethane;4-methyl-1-(oxan-4-yl)pyrazole;2-(3-propan-2-ylphenyl)propan-2-ol has a molecular weight of 374.57 g/mol, XLogP of 5.61, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-1-(oxan-4-yl)pyrazole;2-(3-propan-2-ylphenyl)propan-2-ol is sourced from PubChem (CID 144973147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).