C16H23NO — CID 144973530
3-methyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide (PubChem CID 144973530) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 3-methyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide.
| Compound Name | 3-methyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide |
|---|---|
| PubChem CID | 144973530 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 3-methyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide |
| SMILES | CCC(C)CC(=O)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C16H23NO/c1-3-12(2)11-16(18)17-15-10-6-8-13-7-4-5-9-14(13)15/h4-5,7,9,12,15H,3,6,8,10-11H2,1-2H3,(H,17,18)/t12?,15-/m1/s1 |
| InChIKey | AKLHWWMXVDBVRG-WPZCJLIBSA-N |
| XLogP | 3.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |