About (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide;molecular hydrogen
(2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide;molecular hydrogen (PubChem CID 144973570) has the molecular formula C16H27N3O3
and a molecular weight of 309.41 g/mol. Its IUPAC name is (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide;molecular hydrogen.
Molecular Properties
| Compound Name | (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide;molecular hydrogen |
| PubChem CID | 144973570 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide;molecular hydrogen |
| SMILES | CCC[C@@H](C(=O)NNc1ccccc1)N1COCC(C)C1=O.[H][H].[H][H] |
| InChI | InChI=1S/C16H23N3O3.2H2/c1-3-7-14(19-11-22-10-12(2)16(19)21)15(20)18-17-13-8-5-4-6-9-13;;/h4-6,8-9,12,14,17H,3,7,10-11H2,1-2H3,(H,18,20);2*1H/t12?,14-;;/m0../s1 |
| InChIKey | WWPRYGSGSWOWPQ-IRDULIORSA-N |
| XLogP | 2.24 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide;molecular hydrogen?
The IUPAC name of (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide;molecular hydrogen (CID 144973570) is (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide;molecular hydrogen.
What is the SMILES notation for (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide;molecular hydrogen?
The canonical SMILES for (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide;molecular hydrogen is CCC[C@@H](C(=O)NNc1ccccc1)N1COCC(C)C1=O.[H][H].[H][H].
What is the InChIKey of (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide;molecular hydrogen?
The InChIKey is WWPRYGSGSWOWPQ-IRDULIORSA-N. The full InChI is InChI=1S/C16H23N3O3.2H2/c1-3-7-14(19-11-22-10-12(2)16(19)21)15(20)18-17-13-8-5-4-6-9-13;;/h4-6,8-9,12,14,17H,3,7,10-11H2,1-2H3,(H,18,20);2*1H/t12?,14-;;/m0../s1.
What are the key properties of (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide;molecular hydrogen?
(2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide;molecular hydrogen has a molecular weight of 309.41 g/mol, XLogP of 2.24, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide;molecular hydrogen is sourced from PubChem (CID 144973570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).