About (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide
(2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide (PubChem CID 144973571) has the molecular formula C16H23N3O3
and a molecular weight of 305.38 g/mol. Its IUPAC name is (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide.
Molecular Properties
| Compound Name | (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide |
| PubChem CID | 144973571 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide |
| SMILES | CCC[C@@H](C(=O)NNc1ccccc1)N1COCC(C)C1=O |
| InChI | InChI=1S/C16H23N3O3/c1-3-7-14(19-11-22-10-12(2)16(19)21)15(20)18-17-13-8-5-4-6-9-13/h4-6,8-9,12,14,17H,3,7,10-11H2,1-2H3,(H,18,20)/t12?,14-/m0/s1 |
| InChIKey | NBUMFAYDMYLFQT-PYMCNQPYSA-N |
| XLogP | 1.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide?
The IUPAC name of (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide (CID 144973571) is (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide.
What is the SMILES notation for (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide?
The canonical SMILES for (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide is CCC[C@@H](C(=O)NNc1ccccc1)N1COCC(C)C1=O.
What is the InChIKey of (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide?
The InChIKey is NBUMFAYDMYLFQT-PYMCNQPYSA-N. The full InChI is InChI=1S/C16H23N3O3/c1-3-7-14(19-11-22-10-12(2)16(19)21)15(20)18-17-13-8-5-4-6-9-13/h4-6,8-9,12,14,17H,3,7,10-11H2,1-2H3,(H,18,20)/t12?,14-/m0/s1.
What are the key properties of (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide?
(2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide has a molecular weight of 305.38 g/mol, XLogP of 1.75, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(5-methyl-4-oxo-1,3-oxazinan-3-yl)-N'-phenylpentanehydrazide is sourced from PubChem (CID 144973571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).