C15H21N3O3 — CID 144973576
aniline;3-methyl-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carboxamide (PubChem CID 144973576) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is aniline;3-methyl-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carboxamide.
| Compound Name | aniline;3-methyl-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carboxamide |
|---|---|
| PubChem CID | 144973576 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | aniline;3-methyl-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carboxamide |
| SMILES | CC1COC2CCC(C(N)=O)N2C1=O.Nc1ccccc1 |
| InChI | InChI=1S/C9H14N2O3.C6H7N/c1-5-4-14-7-3-2-6(8(10)12)11(7)9(5)13;7-6-4-2-1-3-5-6/h5-7H,2-4H2,1H3,(H2,10,12);1-5H,7H2 |
| InChIKey | GHQIPURMZRPXLE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|