About 3-[[1-tert-butyl-3-(2,6-dimethoxyphenyl)pyrazole-5-carbonyl]amino]-5-methylhexanoic acid
3-[[1-tert-butyl-3-(2,6-dimethoxyphenyl)pyrazole-5-carbonyl]amino]-5-methylhexanoic acid (PubChem CID 144973898) has the molecular formula C23H33N3O5
and a molecular weight of 431.53 g/mol. Its IUPAC name is 3-[[1-tert-butyl-3-(2,6-dimethoxyphenyl)pyrazole-5-carbonyl]amino]-5-methylhexanoic acid.
Molecular Properties
| Compound Name | 3-[[1-tert-butyl-3-(2,6-dimethoxyphenyl)pyrazole-5-carbonyl]amino]-5-methylhexanoic acid |
| PubChem CID | 144973898 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 3-[[1-tert-butyl-3-(2,6-dimethoxyphenyl)pyrazole-5-carbonyl]amino]-5-methylhexanoic acid |
| SMILES | COc1cccc(OC)c1-c1cc(C(=O)NC(CC(=O)O)CC(C)C)n(C(C)(C)C)n1 |
| InChI | InChI=1S/C23H33N3O5/c1-14(2)11-15(12-20(27)28)24-22(29)17-13-16(25-26(17)23(3,4)5)21-18(30-6)9-8-10-19(21)31-7/h8-10,13-15H,11-12H2,1-7H3,(H,24,29)(H,27,28) |
| InChIKey | IJZHXNPHRAMIQW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[1-tert-butyl-3-(2,6-dimethoxyphenyl)pyrazole-5-carbonyl]amino]-5-methylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-tert-butyl-3-(2,6-dimethoxyphenyl)pyrazole-5-carbonyl]amino]-5-methylhexanoic acid?
The IUPAC name of 3-[[1-tert-butyl-3-(2,6-dimethoxyphenyl)pyrazole-5-carbonyl]amino]-5-methylhexanoic acid (CID 144973898) is 3-[[1-tert-butyl-3-(2,6-dimethoxyphenyl)pyrazole-5-carbonyl]amino]-5-methylhexanoic acid.
What is the SMILES notation for 3-[[1-tert-butyl-3-(2,6-dimethoxyphenyl)pyrazole-5-carbonyl]amino]-5-methylhexanoic acid?
The canonical SMILES for 3-[[1-tert-butyl-3-(2,6-dimethoxyphenyl)pyrazole-5-carbonyl]amino]-5-methylhexanoic acid is COc1cccc(OC)c1-c1cc(C(=O)NC(CC(=O)O)CC(C)C)n(C(C)(C)C)n1.
What is the InChIKey of 3-[[1-tert-butyl-3-(2,6-dimethoxyphenyl)pyrazole-5-carbonyl]amino]-5-methylhexanoic acid?
The InChIKey is IJZHXNPHRAMIQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H33N3O5/c1-14(2)11-15(12-20(27)28)24-22(29)17-13-16(25-26(17)23(3,4)5)21-18(30-6)9-8-10-19(21)31-7/h8-10,13-15H,11-12H2,1-7H3,(H,24,29)(H,27,28).
What are the key properties of 3-[[1-tert-butyl-3-(2,6-dimethoxyphenyl)pyrazole-5-carbonyl]amino]-5-methylhexanoic acid?
3-[[1-tert-butyl-3-(2,6-dimethoxyphenyl)pyrazole-5-carbonyl]amino]-5-methylhexanoic acid has a molecular weight of 431.53 g/mol, XLogP of 3.94, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-tert-butyl-3-(2,6-dimethoxyphenyl)pyrazole-5-carbonyl]amino]-5-methylhexanoic acid is sourced from PubChem (CID 144973898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).