C18H17ClN2O — CID 14497415
3-[5-(4-chlorophenyl)-1-phenylpyrazol-3-yl]propan-1-ol (PubChem CID 14497415) has the molecular formula C18H17ClN2O and a molecular weight of 312.80 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-1-phenylpyrazol-3-yl]propan-1-ol.
| Compound Name | 3-[5-(4-chlorophenyl)-1-phenylpyrazol-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 14497415 |
| Molecular Formula | C18H17ClN2O |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-1-phenylpyrazol-3-yl]propan-1-ol |
| SMILES | OCCCc1cc(-c2ccc(Cl)cc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H17ClN2O/c19-15-10-8-14(9-11-15)18-13-16(5-4-12-22)20-21(18)17-6-2-1-3-7-17/h1-3,6-11,13,22H,4-5,12H2 |
| InChIKey | SIBBWQCNJVAKJZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |