About (4R)-1-(3,5-dichlorophenyl)-3-ethyl-4-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione
(4R)-1-(3,5-dichlorophenyl)-3-ethyl-4-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione (PubChem CID 144974540) has the molecular formula C19H14Cl2F3NO3
and a molecular weight of 432.23 g/mol. Its IUPAC name is (4R)-1-(3,5-dichlorophenyl)-3-ethyl-4-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | (4R)-1-(3,5-dichlorophenyl)-3-ethyl-4-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione |
| PubChem CID | 144974540 |
| Molecular Formula | C19H14Cl2F3NO3 |
| Molecular Weight | 432.23 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | (4R)-1-(3,5-dichlorophenyl)-3-ethyl-4-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione |
| SMILES | CCC1C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)[C@H]1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H14Cl2F3NO3/c1-2-15-16(10-3-5-14(6-4-10)28-19(22,23)24)18(27)25(17(15)26)13-8-11(20)7-12(21)9-13/h3-9,15-16H,2H2,1H3/t15?,16-/m0/s1 |
| InChIKey | JOAFGZMNPOFMAE-LYKKTTPLSA-N |
| XLogP | 5.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.23 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (4R)-1-(3,5-dichlorophenyl)-3-ethyl-4-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1-(3,5-dichlorophenyl)-3-ethyl-4-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione?
The IUPAC name of (4R)-1-(3,5-dichlorophenyl)-3-ethyl-4-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione (CID 144974540) is (4R)-1-(3,5-dichlorophenyl)-3-ethyl-4-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione.
What is the SMILES notation for (4R)-1-(3,5-dichlorophenyl)-3-ethyl-4-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione?
The canonical SMILES for (4R)-1-(3,5-dichlorophenyl)-3-ethyl-4-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione is CCC1C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)[C@H]1c1ccc(OC(F)(F)F)cc1.
What is the InChIKey of (4R)-1-(3,5-dichlorophenyl)-3-ethyl-4-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione?
The InChIKey is JOAFGZMNPOFMAE-LYKKTTPLSA-N. The full InChI is InChI=1S/C19H14Cl2F3NO3/c1-2-15-16(10-3-5-14(6-4-10)28-19(22,23)24)18(27)25(17(15)26)13-8-11(20)7-12(21)9-13/h3-9,15-16H,2H2,1H3/t15?,16-/m0/s1.
What are the key properties of (4R)-1-(3,5-dichlorophenyl)-3-ethyl-4-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione?
(4R)-1-(3,5-dichlorophenyl)-3-ethyl-4-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione has a molecular weight of 432.23 g/mol, XLogP of 5.58, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1-(3,5-dichlorophenyl)-3-ethyl-4-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione is sourced from PubChem (CID 144974540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).