C18H24N4O4 — CID 144975528
2-[2-aminoethyl(methyl)amino]-N-(2,6-dioxo-1-phenacylpiperidin-3-yl)acetamide (PubChem CID 144975528) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-[2-aminoethyl(methyl)amino]-N-(2,6-dioxo-1-phenacylpiperidin-3-yl)acetamide.
| Compound Name | 2-[2-aminoethyl(methyl)amino]-N-(2,6-dioxo-1-phenacylpiperidin-3-yl)acetamide |
|---|---|
| PubChem CID | 144975528 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-[2-aminoethyl(methyl)amino]-N-(2,6-dioxo-1-phenacylpiperidin-3-yl)acetamide |
| SMILES | CN(CCN)CC(=O)NC1CCC(=O)N(CC(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C18H24N4O4/c1-21(10-9-19)12-16(24)20-14-7-8-17(25)22(18(14)26)11-15(23)13-5-3-2-4-6-13/h2-6,14H,7-12,19H2,1H3,(H,20,24) |
| InChIKey | SOMOYMKOGPQQLH-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|