About 2-methylsulfonylethyl (Z)-3-hydroxy-3-(4-hydroxy-9-oxo-4H-benzo[f][1]benzofuran-2-yl)prop-2-enoate
2-methylsulfonylethyl (Z)-3-hydroxy-3-(4-hydroxy-9-oxo-4H-benzo[f][1]benzofuran-2-yl)prop-2-enoate (PubChem CID 144975853) has the molecular formula C18H16O8S
and a molecular weight of 392.39 g/mol. Its IUPAC name is 2-methylsulfonylethyl (Z)-3-hydroxy-3-(4-hydroxy-9-oxo-4H-benzo[f][1]benzofuran-2-yl)prop-2-enoate.
Molecular Properties
| Compound Name | 2-methylsulfonylethyl (Z)-3-hydroxy-3-(4-hydroxy-9-oxo-4H-benzo[f][1]benzofuran-2-yl)prop-2-enoate |
| PubChem CID | 144975853 |
| Molecular Formula | C18H16O8S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 2-methylsulfonylethyl (Z)-3-hydroxy-3-(4-hydroxy-9-oxo-4H-benzo[f][1]benzofuran-2-yl)prop-2-enoate |
| SMILES | CS(=O)(=O)CCOC(=O)/C=C(\O)c1cc2c(o1)C(=O)c1ccccc1C2O |
| InChI | InChI=1S/C18H16O8S/c1-27(23,24)7-6-25-15(20)9-13(19)14-8-12-16(21)10-4-2-3-5-11(10)17(22)18(12)26-14/h2-5,8-9,16,19,21H,6-7H2,1H3/b13-9- |
| InChIKey | IGCZOBQSZMDCRP-LCYFTJDESA-N |
| XLogP | 1.39 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfonylethyl (Z)-3-hydroxy-3-(4-hydroxy-9-oxo-4H-benzo[f][1]benzofuran-2-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfonylethyl (Z)-3-hydroxy-3-(4-hydroxy-9-oxo-4H-benzo[f][1]benzofuran-2-yl)prop-2-enoate?
The IUPAC name of 2-methylsulfonylethyl (Z)-3-hydroxy-3-(4-hydroxy-9-oxo-4H-benzo[f][1]benzofuran-2-yl)prop-2-enoate (CID 144975853) is 2-methylsulfonylethyl (Z)-3-hydroxy-3-(4-hydroxy-9-oxo-4H-benzo[f][1]benzofuran-2-yl)prop-2-enoate.
What is the SMILES notation for 2-methylsulfonylethyl (Z)-3-hydroxy-3-(4-hydroxy-9-oxo-4H-benzo[f][1]benzofuran-2-yl)prop-2-enoate?
The canonical SMILES for 2-methylsulfonylethyl (Z)-3-hydroxy-3-(4-hydroxy-9-oxo-4H-benzo[f][1]benzofuran-2-yl)prop-2-enoate is CS(=O)(=O)CCOC(=O)/C=C(\O)c1cc2c(o1)C(=O)c1ccccc1C2O.
What is the InChIKey of 2-methylsulfonylethyl (Z)-3-hydroxy-3-(4-hydroxy-9-oxo-4H-benzo[f][1]benzofuran-2-yl)prop-2-enoate?
The InChIKey is IGCZOBQSZMDCRP-LCYFTJDESA-N. The full InChI is InChI=1S/C18H16O8S/c1-27(23,24)7-6-25-15(20)9-13(19)14-8-12-16(21)10-4-2-3-5-11(10)17(22)18(12)26-14/h2-5,8-9,16,19,21H,6-7H2,1H3/b13-9-.
What are the key properties of 2-methylsulfonylethyl (Z)-3-hydroxy-3-(4-hydroxy-9-oxo-4H-benzo[f][1]benzofuran-2-yl)prop-2-enoate?
2-methylsulfonylethyl (Z)-3-hydroxy-3-(4-hydroxy-9-oxo-4H-benzo[f][1]benzofuran-2-yl)prop-2-enoate has a molecular weight of 392.39 g/mol, XLogP of 1.39, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfonylethyl (Z)-3-hydroxy-3-(4-hydroxy-9-oxo-4H-benzo[f][1]benzofuran-2-yl)prop-2-enoate is sourced from PubChem (CID 144975853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).