C33H24IN3 — CID 144976081
2-(3-iodocyclohexa-1,3-dien-1-yl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine (PubChem CID 144976081) has the molecular formula C33H24IN3 and a molecular weight of 589.48 g/mol. Its IUPAC name is 2-(3-iodocyclohexa-1,3-dien-1-yl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(3-iodocyclohexa-1,3-dien-1-yl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 144976081 |
| Molecular Formula | C33H24IN3 |
| Molecular Weight | 589.48 g/mol |
| Exact Mass | 589.10 |
| IUPAC Name | 2-(3-iodocyclohexa-1,3-dien-1-yl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
| SMILES | IC1=CCCC(c2nc(-c3cccc(-c4ccccc4)c3)nc(-c3cccc(-c4ccccc4)c3)n2)=C1 |
| InChI | InChI=1S/C33H24IN3/c34-30-19-9-18-29(22-30)33-36-31(27-16-7-14-25(20-27)23-10-3-1-4-11-23)35-32(37-33)28-17-8-15-26(21-28)24-12-5-2-6-13-24/h1-8,10-17,19-22H,9,18H2 |
| InChIKey | GCXLGOKIZUHGMT-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.48 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|