C52H33N5 — CID 144976553
5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-(9-phenylcarbazol-3-yl)cyclohepta[b]indole (PubChem CID 144976553) has the molecular formula C52H33N5 and a molecular weight of 727.87 g/mol. Its IUPAC name is 5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-(9-phenylcarbazol-3-yl)cyclohepta[b]indole.
| Compound Name | 5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-(9-phenylcarbazol-3-yl)cyclohepta[b]indole |
|---|---|
| PubChem CID | 144976553 |
| Molecular Formula | C52H33N5 |
| Molecular Weight | 727.87 g/mol |
| Exact Mass | 727.27 |
| IUPAC Name | 5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-(9-phenylcarbazol-3-yl)cyclohepta[b]indole |
| SMILES | C1=CC(c2ccc3c(c2)c2ccccc2n3-c2ccccc2)=Cc2c(n(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)c3ccccc23)C=1 |
| InChI | InChI=1S/C52H33N5/c1-4-16-35(17-5-1)50-53-51(36-18-6-2-7-19-36)55-52(54-50)39-21-14-24-41(32-39)57-47-28-13-11-25-42(47)44-33-37(20-15-29-48(44)57)38-30-31-49-45(34-38)43-26-10-12-27-46(43)56(49)40-22-8-3-9-23-40/h1-14,16-34H |
| InChIKey | QPYHTJJKNYDNPH-UHFFFAOYSA-N |
| XLogP | 12.64 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.87 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |