C13H26N2O3 — CID 144976875
tert-butyl 2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridine-1-carboxylate;methanol (PubChem CID 144976875) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is tert-butyl 2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridine-1-carboxylate;methanol.
| Compound Name | tert-butyl 2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridine-1-carboxylate;methanol |
|---|---|
| PubChem CID | 144976875 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | tert-butyl 2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridine-1-carboxylate;methanol |
| SMILES | CC(C)(C)OC(=O)N1CCC2CCNCC21.CO |
| InChI | InChI=1S/C12H22N2O2.CH4O/c1-12(2,3)16-11(15)14-7-5-9-4-6-13-8-10(9)14;1-2/h9-10,13H,4-8H2,1-3H3;2H,1H3 |
| InChIKey | NCHXGTRWZKKKFD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |