C20H28N2S — CID 144976987
N-[2-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylethyl]-N-(2-pyrrolidin-1-ylethyl)aniline (PubChem CID 144976987) has the molecular formula C20H28N2S and a molecular weight of 328.53 g/mol. Its IUPAC name is N-[2-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylethyl]-N-(2-pyrrolidin-1-ylethyl)aniline.
| Compound Name | N-[2-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylethyl]-N-(2-pyrrolidin-1-ylethyl)aniline |
|---|---|
| PubChem CID | 144976987 |
| Molecular Formula | C20H28N2S |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | N-[2-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylethyl]-N-(2-pyrrolidin-1-ylethyl)aniline |
| SMILES | C=C/C=C(\C=C)SCCN(CCN1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H28N2S/c1-3-10-20(4-2)23-18-17-22(19-11-6-5-7-12-19)16-15-21-13-8-9-14-21/h3-7,10-12H,1-2,8-9,13-18H2/b20-10+ |
| InChIKey | YBEKNHWDKPCGDP-KEBDBYFISA-N |
| XLogP | 4.58 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|