C18H34N2S — CID 144976993
N'-butan-2-yl-N-[2-(cyclohexa-1,3-dien-1-ylmethylsulfanyl)ethyl]-N'-propylethane-1,2-diamine (PubChem CID 144976993) has the molecular formula C18H34N2S and a molecular weight of 310.55 g/mol. Its IUPAC name is N'-butan-2-yl-N-[2-(cyclohexa-1,3-dien-1-ylmethylsulfanyl)ethyl]-N'-propylethane-1,2-diamine.
| Compound Name | N'-butan-2-yl-N-[2-(cyclohexa-1,3-dien-1-ylmethylsulfanyl)ethyl]-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 144976993 |
| Molecular Formula | C18H34N2S |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | N'-butan-2-yl-N-[2-(cyclohexa-1,3-dien-1-ylmethylsulfanyl)ethyl]-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CCNCCSCC1=CC=CCC1)C(C)CC |
| InChI | InChI=1S/C18H34N2S/c1-4-13-20(17(3)5-2)14-11-19-12-15-21-16-18-9-7-6-8-10-18/h6-7,9,17,19H,4-5,8,10-16H2,1-3H3 |
| InChIKey | FBTSYVPLICCCIR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|