C17H32N2S — CID 144977026
N-[3-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpropyl]-N'-methyl-N'-propylpropane-1,3-diamine (PubChem CID 144977026) has the molecular formula C17H32N2S and a molecular weight of 296.52 g/mol. Its IUPAC name is N-[3-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpropyl]-N'-methyl-N'-propylpropane-1,3-diamine.
| Compound Name | N-[3-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpropyl]-N'-methyl-N'-propylpropane-1,3-diamine |
|---|---|
| PubChem CID | 144977026 |
| Molecular Formula | C17H32N2S |
| Molecular Weight | 296.52 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | N-[3-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpropyl]-N'-methyl-N'-propylpropane-1,3-diamine |
| SMILES | C=C/C=C(\C=C)CSCCCNCCCN(C)CCC |
| InChI | InChI=1S/C17H32N2S/c1-5-10-17(7-3)16-20-15-9-12-18-11-8-14-19(4)13-6-2/h5,7,10,18H,1,3,6,8-9,11-16H2,2,4H3/b17-10+ |
| InChIKey | HTKHJKAPJIZNNZ-LICLKQGHSA-N |
| XLogP | 3.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|