About N'-butyl-N-[2-(cyclohexa-1,3-dien-1-ylmethylsulfanyl)ethyl]-N'-methylethane-1,2-diamine
N'-butyl-N-[2-(cyclohexa-1,3-dien-1-ylmethylsulfanyl)ethyl]-N'-methylethane-1,2-diamine (PubChem CID 144977027) has the molecular formula C16H30N2S
and a molecular weight of 282.50 g/mol. Its IUPAC name is N'-butyl-N-[2-(cyclohexa-1,3-dien-1-ylmethylsulfanyl)ethyl]-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-butyl-N-[2-(cyclohexa-1,3-dien-1-ylmethylsulfanyl)ethyl]-N'-methylethane-1,2-diamine |
| PubChem CID | 144977027 |
| Molecular Formula | C16H30N2S |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N'-butyl-N-[2-(cyclohexa-1,3-dien-1-ylmethylsulfanyl)ethyl]-N'-methylethane-1,2-diamine |
| SMILES | CCCCN(C)CCNCCSCC1=CC=CCC1 |
| InChI | InChI=1S/C16H30N2S/c1-3-4-12-18(2)13-10-17-11-14-19-15-16-8-6-5-7-9-16/h5-6,8,17H,3-4,7,9-15H2,1-2H3 |
| InChIKey | KSDLIGUZUNJPJQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-butyl-N-[2-(cyclohexa-1,3-dien-1-ylmethylsulfanyl)ethyl]-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-butyl-N-[2-(cyclohexa-1,3-dien-1-ylmethylsulfanyl)ethyl]-N'-methylethane-1,2-diamine?
The IUPAC name of N'-butyl-N-[2-(cyclohexa-1,3-dien-1-ylmethylsulfanyl)ethyl]-N'-methylethane-1,2-diamine (CID 144977027) is N'-butyl-N-[2-(cyclohexa-1,3-dien-1-ylmethylsulfanyl)ethyl]-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-butyl-N-[2-(cyclohexa-1,3-dien-1-ylmethylsulfanyl)ethyl]-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-butyl-N-[2-(cyclohexa-1,3-dien-1-ylmethylsulfanyl)ethyl]-N'-methylethane-1,2-diamine is CCCCN(C)CCNCCSCC1=CC=CCC1.
What is the InChIKey of N'-butyl-N-[2-(cyclohexa-1,3-dien-1-ylmethylsulfanyl)ethyl]-N'-methylethane-1,2-diamine?
The InChIKey is KSDLIGUZUNJPJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2S/c1-3-4-12-18(2)13-10-17-11-14-19-15-16-8-6-5-7-9-16/h5-6,8,17H,3-4,7,9-15H2,1-2H3.
What are the key properties of N'-butyl-N-[2-(cyclohexa-1,3-dien-1-ylmethylsulfanyl)ethyl]-N'-methylethane-1,2-diamine?
N'-butyl-N-[2-(cyclohexa-1,3-dien-1-ylmethylsulfanyl)ethyl]-N'-methylethane-1,2-diamine has a molecular weight of 282.50 g/mol, XLogP of 3.32, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-butyl-N-[2-(cyclohexa-1,3-dien-1-ylmethylsulfanyl)ethyl]-N'-methylethane-1,2-diamine is sourced from PubChem (CID 144977027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).