C18H34N2S — CID 144977030
N'-butyl-N-[3-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpropyl]-N'-methylpropane-1,3-diamine (PubChem CID 144977030) has the molecular formula C18H34N2S and a molecular weight of 310.55 g/mol. Its IUPAC name is N'-butyl-N-[3-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpropyl]-N'-methylpropane-1,3-diamine.
| Compound Name | N'-butyl-N-[3-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpropyl]-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 144977030 |
| Molecular Formula | C18H34N2S |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | N'-butyl-N-[3-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpropyl]-N'-methylpropane-1,3-diamine |
| SMILES | C=C/C=C(\C=C)CSCCCNCCCN(C)CCCC |
| InChI | InChI=1S/C18H34N2S/c1-5-8-14-20(4)15-9-12-19-13-10-16-21-17-18(7-3)11-6-2/h6-7,11,19H,2-3,5,8-10,12-17H2,1,4H3/b18-11+ |
| InChIKey | DSKZDXLMYLAHCQ-WOJGMQOQSA-N |
| XLogP | 4.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|