C24H44N2S — CID 144977070
N'-(cyclopentylmethyl)-N-[3-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpropyl]-N'-(3-methylbutan-2-yl)propane-1,3-diamine (PubChem CID 144977070) has the molecular formula C24H44N2S and a molecular weight of 392.70 g/mol. Its IUPAC name is N'-(cyclopentylmethyl)-N-[3-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpropyl]-N'-(3-methylbutan-2-yl)propane-1,3-diamine.
| Compound Name | N'-(cyclopentylmethyl)-N-[3-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpropyl]-N'-(3-methylbutan-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 144977070 |
| Molecular Formula | C24H44N2S |
| Molecular Weight | 392.70 g/mol |
| Exact Mass | 392.32 |
| IUPAC Name | N'-(cyclopentylmethyl)-N-[3-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpropyl]-N'-(3-methylbutan-2-yl)propane-1,3-diamine |
| SMILES | C=C/C=C(\C=C)CSCCCNCCCN(CC1CCCC1)C(C)C(C)C |
| InChI | InChI=1S/C24H44N2S/c1-6-12-23(7-2)20-27-18-11-16-25-15-10-17-26(22(5)21(3)4)19-24-13-8-9-14-24/h6-7,12,21-22,24-25H,1-2,8-11,13-20H2,3-5H3/b23-12+ |
| InChIKey | JMTLXSOVURPZNM-FSJBWODESA-N |
| XLogP | 5.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.70 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|