C12H29NO — CID 144977158
ethane;4-(methoxymethyl)-1,2-dimethylpyrrolidine (PubChem CID 144977158) has the molecular formula C12H29NO and a molecular weight of 203.37 g/mol. Its IUPAC name is ethane;4-(methoxymethyl)-1,2-dimethylpyrrolidine.
| Compound Name | ethane;4-(methoxymethyl)-1,2-dimethylpyrrolidine |
|---|---|
| PubChem CID | 144977158 |
| Molecular Formula | C12H29NO |
| Molecular Weight | 203.37 g/mol |
| Exact Mass | 203.22 |
| IUPAC Name | ethane;4-(methoxymethyl)-1,2-dimethylpyrrolidine |
| SMILES | CC.CC.COCC1CC(C)N(C)C1 |
| InChI | InChI=1S/C8H17NO.2C2H6/c1-7-4-8(6-10-3)5-9(7)2;2*1-2/h7-8H,4-6H2,1-3H3;2*1-2H3 |
| InChIKey | BMHGACRXYHECLG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |