About ethane;4-(methoxymethyl)-1,2-dimethylpyrrolidine
ethane;4-(methoxymethyl)-1,2-dimethylpyrrolidine (PubChem CID 144977158) has the molecular formula C12H29NO
and a molecular weight of 203.37 g/mol. Its IUPAC name is ethane;4-(methoxymethyl)-1,2-dimethylpyrrolidine.
Molecular Properties
| Compound Name | ethane;4-(methoxymethyl)-1,2-dimethylpyrrolidine |
| PubChem CID | 144977158 |
| Molecular Formula | C12H29NO |
| Molecular Weight | 203.37 g/mol |
| Exact Mass | 203.22 |
| IUPAC Name | ethane;4-(methoxymethyl)-1,2-dimethylpyrrolidine |
| SMILES | CC.CC.COCC1CC(C)N(C)C1 |
| InChI | InChI=1S/C8H17NO.2C2H6/c1-7-4-8(6-10-3)5-9(7)2;2*1-2/h7-8H,4-6H2,1-3H3;2*1-2H3 |
| InChIKey | BMHGACRXYHECLG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-(methoxymethyl)-1,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(methoxymethyl)-1,2-dimethylpyrrolidine?
The IUPAC name of ethane;4-(methoxymethyl)-1,2-dimethylpyrrolidine (CID 144977158) is ethane;4-(methoxymethyl)-1,2-dimethylpyrrolidine.
What is the SMILES notation for ethane;4-(methoxymethyl)-1,2-dimethylpyrrolidine?
The canonical SMILES for ethane;4-(methoxymethyl)-1,2-dimethylpyrrolidine is CC.CC.COCC1CC(C)N(C)C1.
What is the InChIKey of ethane;4-(methoxymethyl)-1,2-dimethylpyrrolidine?
The InChIKey is BMHGACRXYHECLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.2C2H6/c1-7-4-8(6-10-3)5-9(7)2;2*1-2/h7-8H,4-6H2,1-3H3;2*1-2H3.
What are the key properties of ethane;4-(methoxymethyl)-1,2-dimethylpyrrolidine?
ethane;4-(methoxymethyl)-1,2-dimethylpyrrolidine has a molecular weight of 203.37 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(methoxymethyl)-1,2-dimethylpyrrolidine is sourced from PubChem (CID 144977158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).