About 1-but-3-enylsulfanylcyclohexa-1,3-diene;ethane;N-methyl-N-propylpropan-1-amine
1-but-3-enylsulfanylcyclohexa-1,3-diene;ethane;N-methyl-N-propylpropan-1-amine (PubChem CID 144978460) has the molecular formula C19H37NS
and a molecular weight of 311.58 g/mol. Its IUPAC name is 1-but-3-enylsulfanylcyclohexa-1,3-diene;ethane;N-methyl-N-propylpropan-1-amine.
Molecular Properties
| Compound Name | 1-but-3-enylsulfanylcyclohexa-1,3-diene;ethane;N-methyl-N-propylpropan-1-amine |
| PubChem CID | 144978460 |
| Molecular Formula | C19H37NS |
| Molecular Weight | 311.58 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | 1-but-3-enylsulfanylcyclohexa-1,3-diene;ethane;N-methyl-N-propylpropan-1-amine |
| SMILES | C=CCCSC1=CC=CCC1.CC.CCCN(C)CCC |
| InChI | InChI=1S/C10H14S.C7H17N.C2H6/c1-2-3-9-11-10-7-5-4-6-8-10;1-4-6-8(3)7-5-2;1-2/h2,4-5,7H,1,3,6,8-9H2;4-7H2,1-3H3;1-2H3 |
| InChIKey | FLDPUJGWVWKXJX-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.58 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-but-3-enylsulfanylcyclohexa-1,3-diene;ethane;N-methyl-N-propylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-3-enylsulfanylcyclohexa-1,3-diene;ethane;N-methyl-N-propylpropan-1-amine?
The IUPAC name of 1-but-3-enylsulfanylcyclohexa-1,3-diene;ethane;N-methyl-N-propylpropan-1-amine (CID 144978460) is 1-but-3-enylsulfanylcyclohexa-1,3-diene;ethane;N-methyl-N-propylpropan-1-amine.
What is the SMILES notation for 1-but-3-enylsulfanylcyclohexa-1,3-diene;ethane;N-methyl-N-propylpropan-1-amine?
The canonical SMILES for 1-but-3-enylsulfanylcyclohexa-1,3-diene;ethane;N-methyl-N-propylpropan-1-amine is C=CCCSC1=CC=CCC1.CC.CCCN(C)CCC.
What is the InChIKey of 1-but-3-enylsulfanylcyclohexa-1,3-diene;ethane;N-methyl-N-propylpropan-1-amine?
The InChIKey is FLDPUJGWVWKXJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14S.C7H17N.C2H6/c1-2-3-9-11-10-7-5-4-6-8-10;1-4-6-8(3)7-5-2;1-2/h2,4-5,7H,1,3,6,8-9H2;4-7H2,1-3H3;1-2H3.
What are the key properties of 1-but-3-enylsulfanylcyclohexa-1,3-diene;ethane;N-methyl-N-propylpropan-1-amine?
1-but-3-enylsulfanylcyclohexa-1,3-diene;ethane;N-methyl-N-propylpropan-1-amine has a molecular weight of 311.58 g/mol, XLogP of 6.29, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-3-enylsulfanylcyclohexa-1,3-diene;ethane;N-methyl-N-propylpropan-1-amine is sourced from PubChem (CID 144978460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).