C19H37NS — CID 144978460
1-but-3-enylsulfanylcyclohexa-1,3-diene;ethane;N-methyl-N-propylpropan-1-amine (PubChem CID 144978460) has the molecular formula C19H37NS and a molecular weight of 311.58 g/mol. Its IUPAC name is 1-but-3-enylsulfanylcyclohexa-1,3-diene;ethane;N-methyl-N-propylpropan-1-amine.
| Compound Name | 1-but-3-enylsulfanylcyclohexa-1,3-diene;ethane;N-methyl-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 144978460 |
| Molecular Formula | C19H37NS |
| Molecular Weight | 311.58 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | 1-but-3-enylsulfanylcyclohexa-1,3-diene;ethane;N-methyl-N-propylpropan-1-amine |
| SMILES | C=CCCSC1=CC=CCC1.CC.CCCN(C)CCC |
| InChI | InChI=1S/C10H14S.C7H17N.C2H6/c1-2-3-9-11-10-7-5-4-6-8-10;1-4-6-8(3)7-5-2;1-2/h2,4-5,7H,1,3,6,8-9H2;4-7H2,1-3H3;1-2H3 |
| InChIKey | FLDPUJGWVWKXJX-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.58 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|