C19H27NO4 — CID 144978549
(4aR)-5-hydroxy-2,6-dimethoxy-4a-[2-(methylamino)ethyl]-1,2,4,9,10,10a-hexahydrophenanthren-3-one (PubChem CID 144978549) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is (4aR)-5-hydroxy-2,6-dimethoxy-4a-[2-(methylamino)ethyl]-1,2,4,9,10,10a-hexahydrophenanthren-3-one.
| Compound Name | (4aR)-5-hydroxy-2,6-dimethoxy-4a-[2-(methylamino)ethyl]-1,2,4,9,10,10a-hexahydrophenanthren-3-one |
|---|---|
| PubChem CID | 144978549 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (4aR)-5-hydroxy-2,6-dimethoxy-4a-[2-(methylamino)ethyl]-1,2,4,9,10,10a-hexahydrophenanthren-3-one |
| SMILES | CNCC[C@@]12CC(=O)C(OC)CC1CCc1ccc(OC)c(O)c12 |
| InChI | InChI=1S/C19H27NO4/c1-20-9-8-19-11-14(21)16(24-3)10-13(19)6-4-12-5-7-15(23-2)18(22)17(12)19/h5,7,13,16,20,22H,4,6,8-11H2,1-3H3/t13?,16?,19-/m1/s1 |
| InChIKey | XDHPORYYNRYFSD-NSRCDFIJSA-N |
| XLogP | 2.19 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |