C31H39N3O2 — CID 144978696
(Z)-2-amino-3-[(4-methylphenyl)methylamino]-N-[4-(4-octan-4-yloxyphenyl)phenyl]prop-2-enamide (PubChem CID 144978696) has the molecular formula C31H39N3O2 and a molecular weight of 485.67 g/mol. Its IUPAC name is (Z)-2-amino-3-[(4-methylphenyl)methylamino]-N-[4-(4-octan-4-yloxyphenyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-amino-3-[(4-methylphenyl)methylamino]-N-[4-(4-octan-4-yloxyphenyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 144978696 |
| Molecular Formula | C31H39N3O2 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | (Z)-2-amino-3-[(4-methylphenyl)methylamino]-N-[4-(4-octan-4-yloxyphenyl)phenyl]prop-2-enamide |
| SMILES | CCCCC(CCC)Oc1ccc(-c2ccc(NC(=O)/C(N)=C/NCc3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H39N3O2/c1-4-6-8-28(7-5-2)36-29-19-15-26(16-20-29)25-13-17-27(18-14-25)34-31(35)30(32)22-33-21-24-11-9-23(3)10-12-24/h9-20,22,28,33H,4-8,21,32H2,1-3H3,(H,34,35)/b30-22- |
| InChIKey | LSFKDSKXWMACCF-SWKFRHMKSA-N |
| XLogP | 6.93 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|