C10H19NO2 — CID 144978881
(3E,5E)-9-amino-7-methylnona-3,5-diene-4,5-diol (PubChem CID 144978881) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (3E,5E)-9-amino-7-methylnona-3,5-diene-4,5-diol.
| Compound Name | (3E,5E)-9-amino-7-methylnona-3,5-diene-4,5-diol |
|---|---|
| PubChem CID | 144978881 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (3E,5E)-9-amino-7-methylnona-3,5-diene-4,5-diol |
| SMILES | CC/C=C(O)\C(O)=C/C(C)CCN |
| InChI | InChI=1S/C10H19NO2/c1-3-4-9(12)10(13)7-8(2)5-6-11/h4,7-8,12-13H,3,5-6,11H2,1-2H3/b9-4+,10-7+ |
| InChIKey | RCNLRDQCLLOKSC-SXFWLWNESA-N |
| XLogP | 2.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|