About 2-(2-fluoroethoxy)-5,6,9-trimethyldecane
2-(2-fluoroethoxy)-5,6,9-trimethyldecane (PubChem CID 144978902) has the molecular formula C15H31FO
and a molecular weight of 246.41 g/mol. Its IUPAC name is 2-(2-fluoroethoxy)-5,6,9-trimethyldecane.
Molecular Properties
| Compound Name | 2-(2-fluoroethoxy)-5,6,9-trimethyldecane |
| PubChem CID | 144978902 |
| Molecular Formula | C15H31FO |
| Molecular Weight | 246.41 g/mol |
| Exact Mass | 246.24 |
| IUPAC Name | 2-(2-fluoroethoxy)-5,6,9-trimethyldecane |
| SMILES | CC(C)CCC(C)C(C)CCC(C)OCCF |
| InChI | InChI=1S/C15H31FO/c1-12(2)6-7-13(3)14(4)8-9-15(5)17-11-10-16/h12-15H,6-11H2,1-5H3 |
| InChIKey | BYWHOIIOEIFTIK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-fluoroethoxy)-5,6,9-trimethyldecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluoroethoxy)-5,6,9-trimethyldecane?
The IUPAC name of 2-(2-fluoroethoxy)-5,6,9-trimethyldecane (CID 144978902) is 2-(2-fluoroethoxy)-5,6,9-trimethyldecane.
What is the SMILES notation for 2-(2-fluoroethoxy)-5,6,9-trimethyldecane?
The canonical SMILES for 2-(2-fluoroethoxy)-5,6,9-trimethyldecane is CC(C)CCC(C)C(C)CCC(C)OCCF.
What is the InChIKey of 2-(2-fluoroethoxy)-5,6,9-trimethyldecane?
The InChIKey is BYWHOIIOEIFTIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31FO/c1-12(2)6-7-13(3)14(4)8-9-15(5)17-11-10-16/h12-15H,6-11H2,1-5H3.
What are the key properties of 2-(2-fluoroethoxy)-5,6,9-trimethyldecane?
2-(2-fluoroethoxy)-5,6,9-trimethyldecane has a molecular weight of 246.41 g/mol, XLogP of 4.85, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluoroethoxy)-5,6,9-trimethyldecane is sourced from PubChem (CID 144978902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).