C23H39FO — CID 144978929
1-(3-fluoropropoxy)-4-(5,6,9-trimethylundec-10-en-2-yl)cyclohexa-1,3-diene (PubChem CID 144978929) has the molecular formula C23H39FO and a molecular weight of 350.56 g/mol. Its IUPAC name is 1-(3-fluoropropoxy)-4-(5,6,9-trimethylundec-10-en-2-yl)cyclohexa-1,3-diene.
| Compound Name | 1-(3-fluoropropoxy)-4-(5,6,9-trimethylundec-10-en-2-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144978929 |
| Molecular Formula | C23H39FO |
| Molecular Weight | 350.56 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | 1-(3-fluoropropoxy)-4-(5,6,9-trimethylundec-10-en-2-yl)cyclohexa-1,3-diene |
| SMILES | C=CC(C)CCC(C)C(C)CCC(C)C1=CC=C(OCCCF)CC1 |
| InChI | InChI=1S/C23H39FO/c1-6-18(2)8-9-19(3)20(4)10-11-21(5)22-12-14-23(15-13-22)25-17-7-16-24/h6,12,14,18-21H,1,7-11,13,15-17H2,2-5H3 |
| InChIKey | LWZRVRKOBSYWGO-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.56 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|