About 10-(3-fluoropropoxy)-3,6,7-trimethylundec-1-ene
10-(3-fluoropropoxy)-3,6,7-trimethylundec-1-ene (PubChem CID 144978930) has the molecular formula C17H33FO
and a molecular weight of 272.45 g/mol. Its IUPAC name is 10-(3-fluoropropoxy)-3,6,7-trimethylundec-1-ene.
Molecular Properties
| Compound Name | 10-(3-fluoropropoxy)-3,6,7-trimethylundec-1-ene |
| PubChem CID | 144978930 |
| Molecular Formula | C17H33FO |
| Molecular Weight | 272.45 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 10-(3-fluoropropoxy)-3,6,7-trimethylundec-1-ene |
| SMILES | C=CC(C)CCC(C)C(C)CCC(C)OCCCF |
| InChI | InChI=1S/C17H33FO/c1-6-14(2)8-9-15(3)16(4)10-11-17(5)19-13-7-12-18/h6,14-17H,1,7-13H2,2-5H3 |
| InChIKey | GZMUZLBLSXSASO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-(3-fluoropropoxy)-3,6,7-trimethylundec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(3-fluoropropoxy)-3,6,7-trimethylundec-1-ene?
The IUPAC name of 10-(3-fluoropropoxy)-3,6,7-trimethylundec-1-ene (CID 144978930) is 10-(3-fluoropropoxy)-3,6,7-trimethylundec-1-ene.
What is the SMILES notation for 10-(3-fluoropropoxy)-3,6,7-trimethylundec-1-ene?
The canonical SMILES for 10-(3-fluoropropoxy)-3,6,7-trimethylundec-1-ene is C=CC(C)CCC(C)C(C)CCC(C)OCCCF.
What is the InChIKey of 10-(3-fluoropropoxy)-3,6,7-trimethylundec-1-ene?
The InChIKey is GZMUZLBLSXSASO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33FO/c1-6-14(2)8-9-15(3)16(4)10-11-17(5)19-13-7-12-18/h6,14-17H,1,7-13H2,2-5H3.
What are the key properties of 10-(3-fluoropropoxy)-3,6,7-trimethylundec-1-ene?
10-(3-fluoropropoxy)-3,6,7-trimethylundec-1-ene has a molecular weight of 272.45 g/mol, XLogP of 5.41, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(3-fluoropropoxy)-3,6,7-trimethylundec-1-ene is sourced from PubChem (CID 144978930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).