C22H37FO — CID 144978944
1-(2-fluoroethoxy)-4-(5,6,9-trimethylundec-10-en-2-yl)cyclohexa-1,3-diene (PubChem CID 144978944) has the molecular formula C22H37FO and a molecular weight of 336.54 g/mol. Its IUPAC name is 1-(2-fluoroethoxy)-4-(5,6,9-trimethylundec-10-en-2-yl)cyclohexa-1,3-diene.
| Compound Name | 1-(2-fluoroethoxy)-4-(5,6,9-trimethylundec-10-en-2-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144978944 |
| Molecular Formula | C22H37FO |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | 1-(2-fluoroethoxy)-4-(5,6,9-trimethylundec-10-en-2-yl)cyclohexa-1,3-diene |
| SMILES | C=CC(C)CCC(C)C(C)CCC(C)C1=CC=C(OCCF)CC1 |
| InChI | InChI=1S/C22H37FO/c1-6-17(2)7-8-18(3)19(4)9-10-20(5)21-11-13-22(14-12-21)24-16-15-23/h6,11,13,17-20H,1,7-10,12,14-16H2,2-5H3 |
| InChIKey | WTKVZMUNAJFDRR-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|