C22H26F5N7O — CID 144979391
5-[(6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N,3-dimethyl-N-(methylideneamino)-N'-(2,2,2-trifluoroethyl)-4,6-dihydropyrrolo[3,4-d]imidazole-2-carboximidamide (PubChem CID 144979391) has the molecular formula C22H26F5N7O and a molecular weight of 499.49 g/mol. Its IUPAC name is 5-[(6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N,3-dimethyl-N-(methylideneamino)-N'-(2,2,2-trifluoroethyl)-4,6-dihydropyrrolo[3,4-d]imidazole-2-carboximidamide.
| Compound Name | 5-[(6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N,3-dimethyl-N-(methylideneamino)-N'-(2,2,2-trifluoroethyl)-4,6-dihydropyrrolo[3,4-d]imidazole-2-carboximidamide |
|---|---|
| PubChem CID | 144979391 |
| Molecular Formula | C22H26F5N7O |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 5-[(6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-N,3-dimethyl-N-(methylideneamino)-N'-(2,2,2-trifluoroethyl)-4,6-dihydropyrrolo[3,4-d]imidazole-2-carboximidamide |
| SMILES | C=NN(C)/C(=N\CC(F)(F)F)c1nc2c(n1C)CN(C1CO[C@H](c3cc(F)ccc3F)C(N)C1)C2 |
| InChI | InChI=1S/C22H26F5N7O/c1-29-33(3)20(30-11-22(25,26)27)21-31-17-8-34(9-18(17)32(21)2)13-7-16(28)19(35-10-13)14-6-12(23)4-5-15(14)24/h4-6,13,16,19H,1,7-11,28H2,2-3H3/b30-20-/t13?,16?,19-/m1/s1 |
| InChIKey | VMPFSJGEKWGDJI-KLGUXVNJSA-N |
| XLogP | 2.73 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|