C21H26F2N6O — CID 144979474
(2R,3S,5R)-5-[2-(1-amino-3-methyliminoprop-1-enyl)-3-methyl-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-2-(2,5-difluorophenyl)oxan-3-amine (PubChem CID 144979474) has the molecular formula C21H26F2N6O and a molecular weight of 416.48 g/mol. Its IUPAC name is (2R,3S,5R)-5-[2-(1-amino-3-methyliminoprop-1-enyl)-3-methyl-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-2-(2,5-difluorophenyl)oxan-3-amine.
| Compound Name | (2R,3S,5R)-5-[2-(1-amino-3-methyliminoprop-1-enyl)-3-methyl-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-2-(2,5-difluorophenyl)oxan-3-amine |
|---|---|
| PubChem CID | 144979474 |
| Molecular Formula | C21H26F2N6O |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (2R,3S,5R)-5-[2-(1-amino-3-methyliminoprop-1-enyl)-3-methyl-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-2-(2,5-difluorophenyl)oxan-3-amine |
| SMILES | C/N=C/C=C(N)c1nc2c(n1C)CN([C@H]1CO[C@H](c3cc(F)ccc3F)[C@@H](N)C1)C2 |
| InChI | InChI=1S/C21H26F2N6O/c1-26-6-5-16(24)21-27-18-9-29(10-19(18)28(21)2)13-8-17(25)20(30-11-13)14-7-12(22)3-4-15(14)23/h3-7,13,17,20H,8-11,24-25H2,1-2H3/b16-5?,26-6+/t13-,17+,20-/m1/s1 |
| InChIKey | WOCDMRFPWVSNSW-ULRCGPDCSA-N |
| XLogP | 1.87 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|