C20H3N11 — CID 144979746
17-prop-1-ynyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-4,5,10,11,16-pentacarbonitrile (PubChem CID 144979746) has the molecular formula C20H3N11 and a molecular weight of 397.32 g/mol. Its IUPAC name is 17-prop-1-ynyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-4,5,10,11,16-pentacarbonitrile.
| Compound Name | 17-prop-1-ynyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-4,5,10,11,16-pentacarbonitrile |
|---|---|
| PubChem CID | 144979746 |
| Molecular Formula | C20H3N11 |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 17-prop-1-ynyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-4,5,10,11,16-pentacarbonitrile |
| SMILES | CC#Cc1nc2c3nc(C#N)c(C#N)nc3c3nc(C#N)c(C#N)nc3c2nc1C#N |
| InChI | InChI=1S/C20H3N11/c1-2-3-9-10(4-21)27-16-15(26-9)17-19(30-12(6-23)11(5-22)28-17)20-18(16)29-13(7-24)14(8-25)31-20/h1H3 |
| InChIKey | DRPHTQIWEIANJR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 196.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|