C23H25N2O+ — CID 144980116
[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyphenyl]-[(1Z,3E)-3-pyridin-4-ylpenta-1,3-dienyl]azanium (PubChem CID 144980116) has the molecular formula C23H25N2O+ and a molecular weight of 345.47 g/mol. Its IUPAC name is [4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyphenyl]-[(1Z,3E)-3-pyridin-4-ylpenta-1,3-dienyl]azanium.
| Compound Name | [4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyphenyl]-[(1Z,3E)-3-pyridin-4-ylpenta-1,3-dienyl]azanium |
|---|---|
| PubChem CID | 144980116 |
| Molecular Formula | C23H25N2O+ |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | [4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyphenyl]-[(1Z,3E)-3-pyridin-4-ylpenta-1,3-dienyl]azanium |
| SMILES | C=C/C=C(\C=C/C)Oc1ccc([NH2+]/C=C\C(=C/C)c2ccncc2)cc1 |
| InChI | InChI=1S/C23H24N2O/c1-4-7-22(8-5-2)26-23-11-9-21(10-12-23)25-18-15-19(6-3)20-13-16-24-17-14-20/h4-18,25H,1H2,2-3H3/p+1/b8-5-,18-15-,19-6+,22-7+ |
| InChIKey | FXNGHTNMRVPCFQ-LAZIASSGSA-O |
| XLogP | 4.92 |
| TPSA | 38.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|