About 2-ethyl-1-(2-ethylheptoxy)-4-nitrobenzene;heptane;propane
2-ethyl-1-(2-ethylheptoxy)-4-nitrobenzene;heptane;propane (PubChem CID 144980214) has the molecular formula C27H51NO3
and a molecular weight of 437.71 g/mol. Its IUPAC name is 2-ethyl-1-(2-ethylheptoxy)-4-nitrobenzene;heptane;propane.
Molecular Properties
| Compound Name | 2-ethyl-1-(2-ethylheptoxy)-4-nitrobenzene;heptane;propane |
| PubChem CID | 144980214 |
| Molecular Formula | C27H51NO3 |
| Molecular Weight | 437.71 g/mol |
| Exact Mass | 437.39 |
| IUPAC Name | 2-ethyl-1-(2-ethylheptoxy)-4-nitrobenzene;heptane;propane |
| SMILES | CCC.CCCCCC(CC)COc1ccc([N+](=O)[O-])cc1CC.CCCCCCC |
| InChI | InChI=1S/C17H27NO3.C7H16.C3H8/c1-4-7-8-9-14(5-2)13-21-17-11-10-16(18(19)20)12-15(17)6-3;1-3-5-7-6-4-2;1-3-2/h10-12,14H,4-9,13H2,1-3H3;3-7H2,1-2H3;3H2,1-2H3 |
| InChIKey | RNSOFFAZJLHQKO-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.71 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-1-(2-ethylheptoxy)-4-nitrobenzene;heptane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-(2-ethylheptoxy)-4-nitrobenzene;heptane;propane?
The IUPAC name of 2-ethyl-1-(2-ethylheptoxy)-4-nitrobenzene;heptane;propane (CID 144980214) is 2-ethyl-1-(2-ethylheptoxy)-4-nitrobenzene;heptane;propane.
What is the SMILES notation for 2-ethyl-1-(2-ethylheptoxy)-4-nitrobenzene;heptane;propane?
The canonical SMILES for 2-ethyl-1-(2-ethylheptoxy)-4-nitrobenzene;heptane;propane is CCC.CCCCCC(CC)COc1ccc([N+](=O)[O-])cc1CC.CCCCCCC.
What is the InChIKey of 2-ethyl-1-(2-ethylheptoxy)-4-nitrobenzene;heptane;propane?
The InChIKey is RNSOFFAZJLHQKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO3.C7H16.C3H8/c1-4-7-8-9-14(5-2)13-21-17-11-10-16(18(19)20)12-15(17)6-3;1-3-5-7-6-4-2;1-3-2/h10-12,14H,4-9,13H2,1-3H3;3-7H2,1-2H3;3H2,1-2H3.
What are the key properties of 2-ethyl-1-(2-ethylheptoxy)-4-nitrobenzene;heptane;propane?
2-ethyl-1-(2-ethylheptoxy)-4-nitrobenzene;heptane;propane has a molecular weight of 437.71 g/mol, XLogP of 9.54, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-(2-ethylheptoxy)-4-nitrobenzene;heptane;propane is sourced from PubChem (CID 144980214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).