C9H15N3 — CID 144980718
3,4,6-trimethyl-3H-azepine-2,5-diamine (PubChem CID 144980718) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 3,4,6-trimethyl-3H-azepine-2,5-diamine.
| Compound Name | 3,4,6-trimethyl-3H-azepine-2,5-diamine |
|---|---|
| PubChem CID | 144980718 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 3,4,6-trimethyl-3H-azepine-2,5-diamine |
| SMILES | CC1=CN=C(N)C(C)C(C)=C1N |
| InChI | InChI=1S/C9H15N3/c1-5-4-12-9(11)7(3)6(2)8(5)10/h4,7H,10H2,1-3H3,(H2,11,12) |
| InChIKey | ZHTAACFIEFRMFD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |