About 3-aminocyclopentan-1-ol;ethane
3-aminocyclopentan-1-ol;ethane (PubChem CID 144981128) has the molecular formula C7H17NO
and a molecular weight of 131.22 g/mol. Its IUPAC name is 3-aminocyclopentan-1-ol;ethane.
Molecular Properties
| Compound Name | 3-aminocyclopentan-1-ol;ethane |
| PubChem CID | 144981128 |
| Molecular Formula | C7H17NO |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.13 |
| IUPAC Name | 3-aminocyclopentan-1-ol;ethane |
| SMILES | CC.NC1CCC(O)C1 |
| InChI | InChI=1S/C5H11NO.C2H6/c6-4-1-2-5(7)3-4;1-2/h4-5,7H,1-3,6H2;1-2H3 |
| InChIKey | VHLHHCMRCWFKKZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-aminocyclopentan-1-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminocyclopentan-1-ol;ethane?
The IUPAC name of 3-aminocyclopentan-1-ol;ethane (CID 144981128) is 3-aminocyclopentan-1-ol;ethane.
What is the SMILES notation for 3-aminocyclopentan-1-ol;ethane?
The canonical SMILES for 3-aminocyclopentan-1-ol;ethane is CC.NC1CCC(O)C1.
What is the InChIKey of 3-aminocyclopentan-1-ol;ethane?
The InChIKey is VHLHHCMRCWFKKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.C2H6/c6-4-1-2-5(7)3-4;1-2/h4-5,7H,1-3,6H2;1-2H3.
What are the key properties of 3-aminocyclopentan-1-ol;ethane?
3-aminocyclopentan-1-ol;ethane has a molecular weight of 131.22 g/mol, XLogP of 0.88, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminocyclopentan-1-ol;ethane is sourced from PubChem (CID 144981128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).