C33H47IN4O3 — CID 144981269
N-[[6-[(dimethyl-λ3-iodanyl)methyl]-4-methyl-2-oxo-1H-pyridin-3-yl]methyl]-3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[2-(1-methylpiperidin-4-yl)ethynyl]benzamide (PubChem CID 144981269) has the molecular formula C33H47IN4O3 and a molecular weight of 674.67 g/mol. Its IUPAC name is N-[[6-[(dimethyl-λ3-iodanyl)methyl]-4-methyl-2-oxo-1H-pyridin-3-yl]methyl]-3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[2-(1-methylpiperidin-4-yl)ethynyl]benzamide.
| Compound Name | N-[[6-[(dimethyl-λ3-iodanyl)methyl]-4-methyl-2-oxo-1H-pyridin-3-yl]methyl]-3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[2-(1-methylpiperidin-4-yl)ethynyl]benzamide |
|---|---|
| PubChem CID | 144981269 |
| Molecular Formula | C33H47IN4O3 |
| Molecular Weight | 674.67 g/mol |
| Exact Mass | 674.27 |
| IUPAC Name | N-[[6-[(dimethyl-λ3-iodanyl)methyl]-4-methyl-2-oxo-1H-pyridin-3-yl]methyl]-3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[2-(1-methylpiperidin-4-yl)ethynyl]benzamide |
| SMILES | CCN(c1cc(C#CC2CCN(C)CC2)cc(C(=O)NCc2c(C)cc(CI(C)C)[nH]c2=O)c1C)C1CCOCC1 |
| InChI | InChI=1S/C33H47IN4O3/c1-7-38(28-12-16-41-17-13-28)31-20-26(9-8-25-10-14-37(6)15-11-25)19-29(24(31)3)32(39)35-22-30-23(2)18-27(21-34(4)5)36-33(30)40/h18-20,25,28H,7,10-17,21-22H2,1-6H3,(H,35,39)(H,36,40) |
| InChIKey | GCONKSIENANUKE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.67 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|