C23H27F3N4S — CID 144981423
7-butylsulfanyl-1-propan-2-yl-2-[4-(trifluoromethyl)pyrimidin-2-yl]-3,4-dihydro-1H-pyrazino[1,2-a]indole (PubChem CID 144981423) has the molecular formula C23H27F3N4S and a molecular weight of 448.56 g/mol. Its IUPAC name is 7-butylsulfanyl-1-propan-2-yl-2-[4-(trifluoromethyl)pyrimidin-2-yl]-3,4-dihydro-1H-pyrazino[1,2-a]indole.
| Compound Name | 7-butylsulfanyl-1-propan-2-yl-2-[4-(trifluoromethyl)pyrimidin-2-yl]-3,4-dihydro-1H-pyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 144981423 |
| Molecular Formula | C23H27F3N4S |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 7-butylsulfanyl-1-propan-2-yl-2-[4-(trifluoromethyl)pyrimidin-2-yl]-3,4-dihydro-1H-pyrazino[1,2-a]indole |
| SMILES | CCCCSc1ccc2cc3n(c2c1)CCN(c1nccc(C(F)(F)F)n1)C3C(C)C |
| InChI | InChI=1S/C23H27F3N4S/c1-4-5-12-31-17-7-6-16-13-19-21(15(2)3)30(11-10-29(19)18(16)14-17)22-27-9-8-20(28-22)23(24,25)26/h6-9,13-15,21H,4-5,10-12H2,1-3H3 |
| InChIKey | FZAIHQNINROOGG-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|