About 2-amino-3-methylbutanal;2,2-dimethoxy-N-methylethanamine
2-amino-3-methylbutanal;2,2-dimethoxy-N-methylethanamine (PubChem CID 144981450) has the molecular formula C10H24N2O3
and a molecular weight of 220.31 g/mol. Its IUPAC name is 2-amino-3-methylbutanal;2,2-dimethoxy-N-methylethanamine.
Molecular Properties
| Compound Name | 2-amino-3-methylbutanal;2,2-dimethoxy-N-methylethanamine |
| PubChem CID | 144981450 |
| Molecular Formula | C10H24N2O3 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 2-amino-3-methylbutanal;2,2-dimethoxy-N-methylethanamine |
| SMILES | CC(C)C(N)C=O.CNCC(OC)OC |
| InChI | InChI=1S/C5H13NO2.C5H11NO/c1-6-4-5(7-2)8-3;1-4(2)5(6)3-7/h5-6H,4H2,1-3H3;3-5H,6H2,1-2H3 |
| InChIKey | INYYBOLYRMGERD-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-methylbutanal;2,2-dimethoxy-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-methylbutanal;2,2-dimethoxy-N-methylethanamine?
The IUPAC name of 2-amino-3-methylbutanal;2,2-dimethoxy-N-methylethanamine (CID 144981450) is 2-amino-3-methylbutanal;2,2-dimethoxy-N-methylethanamine.
What is the SMILES notation for 2-amino-3-methylbutanal;2,2-dimethoxy-N-methylethanamine?
The canonical SMILES for 2-amino-3-methylbutanal;2,2-dimethoxy-N-methylethanamine is CC(C)C(N)C=O.CNCC(OC)OC.
What is the InChIKey of 2-amino-3-methylbutanal;2,2-dimethoxy-N-methylethanamine?
The InChIKey is INYYBOLYRMGERD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO2.C5H11NO/c1-6-4-5(7-2)8-3;1-4(2)5(6)3-7/h5-6H,4H2,1-3H3;3-5H,6H2,1-2H3.
What are the key properties of 2-amino-3-methylbutanal;2,2-dimethoxy-N-methylethanamine?
2-amino-3-methylbutanal;2,2-dimethoxy-N-methylethanamine has a molecular weight of 220.31 g/mol, XLogP of -0.01, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-methylbutanal;2,2-dimethoxy-N-methylethanamine is sourced from PubChem (CID 144981450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).