C13H22N2O — CID 144981516
(E)-N-butyl-2-cyano-N,5-dimethylhex-2-enamide (PubChem CID 144981516) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is (E)-N-butyl-2-cyano-N,5-dimethylhex-2-enamide.
| Compound Name | (E)-N-butyl-2-cyano-N,5-dimethylhex-2-enamide |
|---|---|
| PubChem CID | 144981516 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | (E)-N-butyl-2-cyano-N,5-dimethylhex-2-enamide |
| SMILES | CCCCN(C)C(=O)/C(C#N)=C/CC(C)C |
| InChI | InChI=1S/C13H22N2O/c1-5-6-9-15(4)13(16)12(10-14)8-7-11(2)3/h8,11H,5-7,9H2,1-4H3/b12-8+ |
| InChIKey | VOPRFFBUEDHCIB-XYOKQWHBSA-N |
| XLogP | 2.74 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|