C17H16N2O7S3 — CID 144981896
3-acetamido-6-[2-(4-thiocyanatophenyl)ethenyl]cyclohexa-2,4-diene-1,1-disulfonic acid (PubChem CID 144981896) has the molecular formula C17H16N2O7S3 and a molecular weight of 456.52 g/mol. Its IUPAC name is 3-acetamido-6-[2-(4-thiocyanatophenyl)ethenyl]cyclohexa-2,4-diene-1,1-disulfonic acid.
| Compound Name | 3-acetamido-6-[2-(4-thiocyanatophenyl)ethenyl]cyclohexa-2,4-diene-1,1-disulfonic acid |
|---|---|
| PubChem CID | 144981896 |
| Molecular Formula | C17H16N2O7S3 |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | 3-acetamido-6-[2-(4-thiocyanatophenyl)ethenyl]cyclohexa-2,4-diene-1,1-disulfonic acid |
| SMILES | CC(=O)NC1=CC(S(=O)(=O)O)(S(=O)(=O)O)C(C=Cc2ccc(SC#N)cc2)C=C1 |
| InChI | InChI=1S/C17H16N2O7S3/c1-12(20)19-15-7-6-14(17(10-15,28(21,22)23)29(24,25)26)5-2-13-3-8-16(9-4-13)27-11-18/h2-10,14H,1H3,(H,19,20)(H,21,22,23)(H,24,25,26) |
| InChIKey | MGSKLWUFNLIWTG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 161.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|