C15H15F4N5O3S — CID 144981964
N-[N'-[(Z)-1-amino-1-cyano-3,3,3-trifluoroprop-1-en-2-yl]carbamimidoyl]-3-(4-fluorophenyl)sulfonyl-2-methylpropanamide (PubChem CID 144981964) has the molecular formula C15H15F4N5O3S and a molecular weight of 421.38 g/mol. Its IUPAC name is N-[N'-[(Z)-1-amino-1-cyano-3,3,3-trifluoroprop-1-en-2-yl]carbamimidoyl]-3-(4-fluorophenyl)sulfonyl-2-methylpropanamide.
| Compound Name | N-[N'-[(Z)-1-amino-1-cyano-3,3,3-trifluoroprop-1-en-2-yl]carbamimidoyl]-3-(4-fluorophenyl)sulfonyl-2-methylpropanamide |
|---|---|
| PubChem CID | 144981964 |
| Molecular Formula | C15H15F4N5O3S |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | N-[N'-[(Z)-1-amino-1-cyano-3,3,3-trifluoroprop-1-en-2-yl]carbamimidoyl]-3-(4-fluorophenyl)sulfonyl-2-methylpropanamide |
| SMILES | CC(CS(=O)(=O)c1ccc(F)cc1)C(=O)N/C(N)=N/C(=C(\N)C#N)C(F)(F)F |
| InChI | InChI=1S/C15H15F4N5O3S/c1-8(7-28(26,27)10-4-2-9(16)3-5-10)13(25)24-14(22)23-12(11(21)6-20)15(17,18)19/h2-5,8H,7,21H2,1H3,(H3,22,23,24,25)/b12-11- |
| InChIKey | GHIBLTBDCPKCEG-QXMHVHEDSA-N |
| XLogP | 0.92 |
| TPSA | 151.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|