About 6-bromo-2-(2,4-difluorophenyl)-3-hydroxyquinoline-4-carboxylic acid
6-bromo-2-(2,4-difluorophenyl)-3-hydroxyquinoline-4-carboxylic acid (PubChem CID 14498199) has the molecular formula C16H8BrF2NO3
and a molecular weight of 380.14 g/mol. Its IUPAC name is 6-bromo-2-(2,4-difluorophenyl)-3-hydroxyquinoline-4-carboxylic acid.
Molecular Properties
| Compound Name | 6-bromo-2-(2,4-difluorophenyl)-3-hydroxyquinoline-4-carboxylic acid |
| PubChem CID | 14498199 |
| Molecular Formula | C16H8BrF2NO3 |
| Molecular Weight | 380.14 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | 6-bromo-2-(2,4-difluorophenyl)-3-hydroxyquinoline-4-carboxylic acid |
| SMILES | O=C(O)c1c(O)c(-c2ccc(F)cc2F)nc2ccc(Br)cc12 |
| InChI | InChI=1S/C16H8BrF2NO3/c17-7-1-4-12-10(5-7)13(16(22)23)15(21)14(20-12)9-3-2-8(18)6-11(9)19/h1-6,21H,(H,22,23) |
| InChIKey | FUMQOYHNMNUXSW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.14 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-2-(2,4-difluorophenyl)-3-hydroxyquinoline-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(2,4-difluorophenyl)-3-hydroxyquinoline-4-carboxylic acid?
The IUPAC name of 6-bromo-2-(2,4-difluorophenyl)-3-hydroxyquinoline-4-carboxylic acid (CID 14498199) is 6-bromo-2-(2,4-difluorophenyl)-3-hydroxyquinoline-4-carboxylic acid.
What is the SMILES notation for 6-bromo-2-(2,4-difluorophenyl)-3-hydroxyquinoline-4-carboxylic acid?
The canonical SMILES for 6-bromo-2-(2,4-difluorophenyl)-3-hydroxyquinoline-4-carboxylic acid is O=C(O)c1c(O)c(-c2ccc(F)cc2F)nc2ccc(Br)cc12.
What is the InChIKey of 6-bromo-2-(2,4-difluorophenyl)-3-hydroxyquinoline-4-carboxylic acid?
The InChIKey is FUMQOYHNMNUXSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8BrF2NO3/c17-7-1-4-12-10(5-7)13(16(22)23)15(21)14(20-12)9-3-2-8(18)6-11(9)19/h1-6,21H,(H,22,23).
What are the key properties of 6-bromo-2-(2,4-difluorophenyl)-3-hydroxyquinoline-4-carboxylic acid?
6-bromo-2-(2,4-difluorophenyl)-3-hydroxyquinoline-4-carboxylic acid has a molecular weight of 380.14 g/mol, XLogP of 4.35, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(2,4-difluorophenyl)-3-hydroxyquinoline-4-carboxylic acid is sourced from PubChem (CID 14498199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).