C13H19N5O2S — CID 144982102
3,5-dimethyl-1,2,4-oxadiazole;3,5-dimethyl-1,2-oxazole;2,5-dimethyl-1,3,4-thiadiazole (PubChem CID 144982102) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is 3,5-dimethyl-1,2,4-oxadiazole;3,5-dimethyl-1,2-oxazole;2,5-dimethyl-1,3,4-thiadiazole.
| Compound Name | 3,5-dimethyl-1,2,4-oxadiazole;3,5-dimethyl-1,2-oxazole;2,5-dimethyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 144982102 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3,5-dimethyl-1,2,4-oxadiazole;3,5-dimethyl-1,2-oxazole;2,5-dimethyl-1,3,4-thiadiazole |
| SMILES | Cc1cc(C)on1.Cc1nnc(C)s1.Cc1noc(C)n1 |
| InChI | InChI=1S/C5H7NO.C4H6N2O.C4H6N2S/c1-4-3-5(2)7-6-4;1-3-5-4(2)7-6-3;1-3-5-6-4(2)7-3/h3H,1-2H3;2*1-2H3 |
| InChIKey | YVDGKPIATCYGDP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |